C17H27NO4S2 — CID 134881745
(11-sulfosulfanylundecanoylamino)benzene (PubChem CID 134881745) has the molecular formula C17H27NO4S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (11-sulfosulfanylundecanoylamino)benzene.
| Compound Name | (11-sulfosulfanylundecanoylamino)benzene |
|---|---|
| PubChem CID | 134881745 |
| Molecular Formula | C17H27NO4S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (11-sulfosulfanylundecanoylamino)benzene |
| SMILES | O=C(CCCCCCCCCCSS(=O)(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C17H27NO4S2/c19-17(18-16-12-8-7-9-13-16)14-10-5-3-1-2-4-6-11-15-23-24(20,21)22/h7-9,12-13H,1-6,10-11,14-15H2,(H,18,19)(H,20,21,22) |
| InChIKey | PBDITIONBYOPMK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|