About 8-oxo-N-phenyloctanamide
8-oxo-N-phenyloctanamide (PubChem CID 15739209) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 8-oxo-N-phenyloctanamide.
Molecular Properties
| Compound Name | 8-oxo-N-phenyloctanamide |
| PubChem CID | 15739209 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 8-oxo-N-phenyloctanamide |
| SMILES | O=CCCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c16-12-8-3-1-2-7-11-14(17)15-13-9-5-4-6-10-13/h4-6,9-10,12H,1-3,7-8,11H2,(H,15,17) |
| InChIKey | CXAOMOYRWAJOSV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-oxo-N-phenyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-N-phenyloctanamide?
The IUPAC name of 8-oxo-N-phenyloctanamide (CID 15739209) is 8-oxo-N-phenyloctanamide.
What is the SMILES notation for 8-oxo-N-phenyloctanamide?
The canonical SMILES for 8-oxo-N-phenyloctanamide is O=CCCCCCCC(=O)Nc1ccccc1.
What is the InChIKey of 8-oxo-N-phenyloctanamide?
The InChIKey is CXAOMOYRWAJOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c16-12-8-3-1-2-7-11-14(17)15-13-9-5-4-6-10-13/h4-6,9-10,12H,1-3,7-8,11H2,(H,15,17).
What are the key properties of 8-oxo-N-phenyloctanamide?
8-oxo-N-phenyloctanamide has a molecular weight of 233.31 g/mol, XLogP of 3.16, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-N-phenyloctanamide is sourced from PubChem (CID 15739209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).