C14H22N2O2 — CID 143464966
formamide;N-phenylheptanamide (PubChem CID 143464966) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is formamide;N-phenylheptanamide.
| Compound Name | formamide;N-phenylheptanamide |
|---|---|
| PubChem CID | 143464966 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | formamide;N-phenylheptanamide |
| SMILES | CCCCCCC(=O)Nc1ccccc1.NC=O |
| InChI | InChI=1S/C13H19NO.CH3NO/c1-2-3-4-8-11-13(15)14-12-9-6-5-7-10-12;2-1-3/h5-7,9-10H,2-4,8,11H2,1H3,(H,14,15);1H,(H2,2,3) |
| InChIKey | ARRVYVNHEDMVNV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|