C18H30N2O — CID 154099763
4-amino-N-phenyldodecanamide (PubChem CID 154099763) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-amino-N-phenyldodecanamide.
| Compound Name | 4-amino-N-phenyldodecanamide |
|---|---|
| PubChem CID | 154099763 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 4-amino-N-phenyldodecanamide |
| SMILES | CCCCCCCCC(N)CCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-2-3-4-5-6-8-11-16(19)14-15-18(21)20-17-12-9-7-10-13-17/h7,9-10,12-13,16H,2-6,8,11,14-15,19H2,1H3,(H,20,21) |
| InChIKey | AVDBPANLAUIUET-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|