C19H30N2O3 — CID 134143927
N-hydroxy-2-pentyl-N'-phenyloctanediamide (PubChem CID 134143927) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-hydroxy-2-pentyl-N'-phenyloctanediamide.
| Compound Name | N-hydroxy-2-pentyl-N'-phenyloctanediamide |
|---|---|
| PubChem CID | 134143927 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-hydroxy-2-pentyl-N'-phenyloctanediamide |
| SMILES | CCCCCC(CCCCCC(=O)Nc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C19H30N2O3/c1-2-3-6-11-16(19(23)21-24)12-7-4-10-15-18(22)20-17-13-8-5-9-14-17/h5,8-9,13-14,16,24H,2-4,6-7,10-12,15H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HHEJLIRVCLXQMR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|