About 6-oxo-N-phenylhexanamide
6-oxo-N-phenylhexanamide (PubChem CID 19422082) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-oxo-N-phenylhexanamide.
Molecular Properties
| Compound Name | 6-oxo-N-phenylhexanamide |
| PubChem CID | 19422082 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-oxo-N-phenylhexanamide |
| SMILES | O=CCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c14-10-6-2-5-9-12(15)13-11-7-3-1-4-8-11/h1,3-4,7-8,10H,2,5-6,9H2,(H,13,15) |
| InChIKey | SAFVBEYOKFUVGE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-N-phenylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-phenylhexanamide?
The IUPAC name of 6-oxo-N-phenylhexanamide (CID 19422082) is 6-oxo-N-phenylhexanamide.
What is the SMILES notation for 6-oxo-N-phenylhexanamide?
The canonical SMILES for 6-oxo-N-phenylhexanamide is O=CCCCCC(=O)Nc1ccccc1.
What is the InChIKey of 6-oxo-N-phenylhexanamide?
The InChIKey is SAFVBEYOKFUVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-10-6-2-5-9-12(15)13-11-7-3-1-4-8-11/h1,3-4,7-8,10H,2,5-6,9H2,(H,13,15).
What are the key properties of 6-oxo-N-phenylhexanamide?
6-oxo-N-phenylhexanamide has a molecular weight of 205.26 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-phenylhexanamide is sourced from PubChem (CID 19422082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).