C17H17F2NO3S2 — CID 8701315
N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 8701315) has the molecular formula C17H17F2NO3S2 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 8701315 |
| Molecular Formula | C17H17F2NO3S2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F2NO3S2/c1-12-2-8-15(9-3-12)25(22,23)11-10-16(21)20-13-4-6-14(7-5-13)24-17(18)19/h2-9,17H,10-11H2,1H3,(H,20,21) |
| InChIKey | ZNTKVYWMZOKFKP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |