C14H13F2NO2S2 — CID 1051878
N-[4-(difluoromethylsulfanyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 1051878) has the molecular formula C14H13F2NO2S2 and a molecular weight of 329.39 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1051878 |
| Molecular Formula | C14H13F2NO2S2 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H13F2NO2S2/c1-10-2-8-13(9-3-10)21(18,19)17-11-4-6-12(7-5-11)20-14(15)16/h2-9,14,17H,1H3 |
| InChIKey | KPBWBMRGHUBZHY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |