C23H25NO2S2 — CID 141122627
4-methyl-N-[4-[(4-propan-2-ylphenyl)methylsulfanyl]phenyl]benzenesulfonamide (PubChem CID 141122627) has the molecular formula C23H25NO2S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-methyl-N-[4-[(4-propan-2-ylphenyl)methylsulfanyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[(4-propan-2-ylphenyl)methylsulfanyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141122627 |
| Molecular Formula | C23H25NO2S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-methyl-N-[4-[(4-propan-2-ylphenyl)methylsulfanyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SCc3ccc(C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H25NO2S2/c1-17(2)20-8-6-19(7-9-20)16-27-22-12-10-21(11-13-22)24-28(25,26)23-14-4-18(3)5-15-23/h4-15,17,24H,16H2,1-3H3 |
| InChIKey | CNPRIWWQQZIOHP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |