C24H27NO3S2 — CID 141122630
N-[4-[(4-butoxyphenyl)methylsulfanyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 141122630) has the molecular formula C24H27NO3S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[4-[(4-butoxyphenyl)methylsulfanyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[(4-butoxyphenyl)methylsulfanyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 141122630 |
| Molecular Formula | C24H27NO3S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[4-[(4-butoxyphenyl)methylsulfanyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | CCCCOc1ccc(CSc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H27NO3S2/c1-3-4-17-28-22-11-7-20(8-12-22)18-29-23-13-9-21(10-14-23)25-30(26,27)24-15-5-19(2)6-16-24/h5-16,25H,3-4,17-18H2,1-2H3 |
| InChIKey | KJGHTJTWERANKE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|