C28H31N5O3S — CID 122297616
4-butoxy-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide (PubChem CID 122297616) has the molecular formula C28H31N5O3S and a molecular weight of 517.66 g/mol. Its IUPAC name is 4-butoxy-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122297616 |
| Molecular Formula | C28H31N5O3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 4-butoxy-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(Nc4ccc(C)cc4)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C28H31N5O3S/c1-4-5-18-36-25-14-16-26(17-15-25)37(34,35)33-24-12-10-23(11-13-24)32-28-19-27(29-21(3)30-28)31-22-8-6-20(2)7-9-22/h6-17,19,33H,4-5,18H2,1-3H3,(H2,29,30,31,32) |
| InChIKey | KCAOMFIIEDPEOG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|