C24H22N6O4S — CID 122297886
N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-nitrobenzenesulfonamide (PubChem CID 122297886) has the molecular formula C24H22N6O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122297886 |
| Molecular Formula | C24H22N6O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C24H22N6O4S/c1-16-3-5-18(6-4-16)27-23-15-24(26-17(2)25-23)28-19-7-9-20(10-8-19)29-35(33,34)22-13-11-21(12-14-22)30(31)32/h3-15,29H,1-2H3,(H2,25,26,27,28) |
| InChIKey | QJFADPVLNZSONG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|