C19H20IN5O2S — CID 122324445
N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-iodobenzenesulfonamide (PubChem CID 122324445) has the molecular formula C19H20IN5O2S and a molecular weight of 509.37 g/mol. Its IUPAC name is N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 122324445 |
| Molecular Formula | C19H20IN5O2S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-iodobenzenesulfonamide |
| SMILES | CCNc1cc(Nc2ccc(NS(=O)(=O)c3ccc(I)cc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H20IN5O2S/c1-3-21-18-12-19(23-13(2)22-18)24-15-6-8-16(9-7-15)25-28(26,27)17-10-4-14(20)5-11-17/h4-12,25H,3H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | MITHTQZYRVPPSC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|