C25H25N5O3S — CID 122324162
N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-phenoxybenzenesulfonamide (PubChem CID 122324162) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122324162 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-4-phenoxybenzenesulfonamide |
| SMILES | CCNc1cc(Nc2ccc(NS(=O)(=O)c3ccc(Oc4ccccc4)cc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C25H25N5O3S/c1-3-26-24-17-25(28-18(2)27-24)29-19-9-11-20(12-10-19)30-34(31,32)23-15-13-22(14-16-23)33-21-7-5-4-6-8-21/h4-17,30H,3H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | UAVXKRNGISUPPH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |