C22H19IN6O2S — CID 122317368
4-iodo-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide (PubChem CID 122317368) has the molecular formula C22H19IN6O2S and a molecular weight of 558.41 g/mol. Its IUPAC name is 4-iodo-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 4-iodo-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122317368 |
| Molecular Formula | C22H19IN6O2S |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 4-iodo-N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
| SMILES | Cc1nc(Nc2ccc(NS(=O)(=O)c3ccc(I)cc3)cc2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C22H19IN6O2S/c1-15-25-21(14-22(26-15)28-20-4-2-3-13-24-20)27-17-7-9-18(10-8-17)29-32(30,31)19-11-5-16(23)6-12-19/h2-14,29H,1H3,(H2,24,25,26,27,28) |
| InChIKey | UOPJYZJWTZQRRR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|