C13H11N3O6S — CID 169370127
N-(3,5-dinitrophenyl)-4-methylbenzenesulfonamide (PubChem CID 169370127) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is N-(3,5-dinitrophenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3,5-dinitrophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169370127 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-(3,5-dinitrophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C13H11N3O6S/c1-9-2-4-13(5-3-9)23(21,22)14-10-6-11(15(17)18)8-12(7-10)16(19)20/h2-8,14H,1H3 |
| InChIKey | DASHXZBJTDDOGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|