C25H27NO7S — CID 68692100
4-[2-[4-[(4-butoxyphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid (PubChem CID 68692100) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is 4-[2-[4-[(4-butoxyphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[4-[(4-butoxyphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68692100 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[2-[4-[(4-butoxyphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(OCCOc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H27NO7S/c1-2-3-16-31-23-12-14-24(15-13-23)34(29,30)26-20-6-10-22(11-7-20)33-18-17-32-21-8-4-19(5-9-21)25(27)28/h4-15,26H,2-3,16-18H2,1H3,(H,27,28) |
| InChIKey | ZQMCYOGXSJSVMF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|