C16H16BrNO5S — CID 16645073
4-[(4-bromo-3-propoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 16645073) has the molecular formula C16H16BrNO5S and a molecular weight of 414.28 g/mol. Its IUPAC name is 4-[(4-bromo-3-propoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(4-bromo-3-propoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 16645073 |
| Molecular Formula | C16H16BrNO5S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 4-[(4-bromo-3-propoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCOc1cc(S(=O)(=O)Nc2ccc(C(=O)O)cc2)ccc1Br |
| InChI | InChI=1S/C16H16BrNO5S/c1-2-9-23-15-10-13(7-8-14(15)17)24(21,22)18-12-5-3-11(4-6-12)16(19)20/h3-8,10,18H,2,9H2,1H3,(H,19,20) |
| InChIKey | OFOYKAQTZIHFKT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |