C16H17NO6S — CID 1260151
2-[4-[(4-ethoxyphenyl)sulfonylamino]phenoxy]acetic acid (PubChem CID 1260151) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-[4-[(4-ethoxyphenyl)sulfonylamino]phenoxy]acetic acid.
| Compound Name | 2-[4-[(4-ethoxyphenyl)sulfonylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1260151 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[4-[(4-ethoxyphenyl)sulfonylamino]phenoxy]acetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H17NO6S/c1-2-22-13-7-9-15(10-8-13)24(20,21)17-12-3-5-14(6-4-12)23-11-16(18)19/h3-10,17H,2,11H2,1H3,(H,18,19) |
| InChIKey | HHVFQCSRFJEFKU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |