C15H14NO6S- — CID 54710151
2-carboxy-4-[(4-ethoxyphenyl)sulfonylamino]phenolate (PubChem CID 54710151) has the molecular formula C15H14NO6S- and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-carboxy-4-[(4-ethoxyphenyl)sulfonylamino]phenolate.
| Compound Name | 2-carboxy-4-[(4-ethoxyphenyl)sulfonylamino]phenolate |
|---|---|
| PubChem CID | 54710151 |
| Molecular Formula | C15H14NO6S- |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-carboxy-4-[(4-ethoxyphenyl)sulfonylamino]phenolate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc([O-])c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H15NO6S/c1-2-22-11-4-6-12(7-5-11)23(20,21)16-10-3-8-14(17)13(9-10)15(18)19/h3-9,16-17H,2H2,1H3,(H,18,19)/p-1 |
| InChIKey | BDXRLTTUPKKFML-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |