C23H25N3O5S — CID 53001970
2-[benzyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 53001970) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 2-[benzyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53001970 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cnc(N(CC)Cc3ccccc3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-3-26(16-17-8-6-5-7-9-17)22-21(23(27)28)14-18(15-24-22)25-32(29,30)20-12-10-19(11-13-20)31-4-2/h5-15,25H,3-4,16H2,1-2H3,(H,27,28) |
| InChIKey | VKLRDFVTLJXIHW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |