C20H27N3O5S — CID 53024735
2-[butyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 53024735) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 2-[butyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53024735 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[butyl(ethyl)amino]-5-[(4-ethoxyphenyl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | CCCCN(CC)c1ncc(NS(=O)(=O)c2ccc(OCC)cc2)cc1C(=O)O |
| InChI | InChI=1S/C20H27N3O5S/c1-4-7-12-23(5-2)19-18(20(24)25)13-15(14-21-19)22-29(26,27)17-10-8-16(9-11-17)28-6-3/h8-11,13-14,22H,4-7,12H2,1-3H3,(H,24,25) |
| InChIKey | JNZVMMRXBAWXRS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |