C27H23ClN2O3S2 — CID 126414840
N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide (PubChem CID 126414840) has the molecular formula C27H23ClN2O3S2 and a molecular weight of 523.08 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 126414840 |
| Molecular Formula | C27H23ClN2O3S2 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4cccc(Cl)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H23ClN2O3S2/c1-19-5-13-25(14-6-19)34-18-20-7-9-21(10-8-20)27(31)29-23-11-15-26(16-12-23)35(32,33)30-24-4-2-3-22(28)17-24/h2-17,30H,18H2,1H3,(H,29,31) |
| InChIKey | NMINGKFKFFBYBB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |