C22H22ClN3O5S2 — CID 21367810
N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[ethylsulfonyl(methyl)amino]benzamide (PubChem CID 21367810) has the molecular formula C22H22ClN3O5S2 and a molecular weight of 508.02 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[ethylsulfonyl(methyl)amino]benzamide.
| Compound Name | N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[ethylsulfonyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 21367810 |
| Molecular Formula | C22H22ClN3O5S2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | N-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-4-[ethylsulfonyl(methyl)amino]benzamide |
| SMILES | CCS(=O)(=O)N(C)c1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C22H22ClN3O5S2/c1-3-32(28,29)26(2)20-11-7-16(8-12-20)22(27)24-18-9-13-21(14-10-18)33(30,31)25-19-6-4-5-17(23)15-19/h4-15,25H,3H2,1-2H3,(H,24,27) |
| InChIKey | IXTLQQUXHKSASW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |