C27H25N3O5S2 — CID 43879853
4-[benzenesulfonyl(methyl)amino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 43879853) has the molecular formula C27H25N3O5S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is 4-[benzenesulfonyl(methyl)amino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-[benzenesulfonyl(methyl)amino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43879853 |
| Molecular Formula | C27H25N3O5S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 4-[benzenesulfonyl(methyl)amino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(N(C)S(=O)(=O)c4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C27H25N3O5S2/c1-20-7-6-8-23(19-20)29-36(32,33)25-17-13-22(14-18-25)28-27(31)21-11-15-24(16-12-21)30(2)37(34,35)26-9-4-3-5-10-26/h3-19,29H,1-2H3,(H,28,31) |
| InChIKey | KHYUHEBRQMQJJM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |