C21H20N2O3S — CID 1226832
4-methyl-N-[4-[methyl(phenyl)sulfamoyl]phenyl]benzamide (PubChem CID 1226832) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-methyl-N-[4-[methyl(phenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-methyl-N-[4-[methyl(phenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 1226832 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-methyl-N-[4-[methyl(phenyl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-16-8-10-17(11-9-16)21(24)22-18-12-14-20(15-13-18)27(25,26)23(2)19-6-4-3-5-7-19/h3-15H,1-2H3,(H,22,24) |
| InChIKey | NNUSYJSCRVNNLS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |