C27H25N3O6S2 — CID 43882282
4-[benzenesulfonyl(methyl)amino]-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 43882282) has the molecular formula C27H25N3O6S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is 4-[benzenesulfonyl(methyl)amino]-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-[benzenesulfonyl(methyl)amino]-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43882282 |
| Molecular Formula | C27H25N3O6S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 4-[benzenesulfonyl(methyl)amino]-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(N(C)S(=O)(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O6S2/c1-30(38(34,35)26-6-4-3-5-7-26)23-14-8-20(9-15-23)27(31)28-21-12-18-25(19-13-21)37(32,33)29-22-10-16-24(36-2)17-11-22/h3-19,29H,1-2H3,(H,28,31) |
| InChIKey | LNDZQZABFWHJMD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |