C23H23ClN2O3S2 — CID 93487348
(2R)-2-(4-chlorophenyl)sulfanyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]butanamide (PubChem CID 93487348) has the molecular formula C23H23ClN2O3S2 and a molecular weight of 475.04 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 93487348 |
| Molecular Formula | C23H23ClN2O3S2 |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O3S2/c1-3-22(30-20-12-6-17(24)7-13-20)23(27)25-18-10-14-21(15-11-18)31(28,29)26-19-8-4-16(2)5-9-19/h4-15,22,26H,3H2,1-2H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | QZPPPXICYYTNKO-JOCHJYFZSA-N |
| XLogP | 5.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |