C21H20ClN3O3S2 — CID 28573679
(2S)-2-(4-chlorophenyl)sulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]butanamide (PubChem CID 28573679) has the molecular formula C21H20ClN3O3S2 and a molecular weight of 462.00 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]butanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 28573679 |
| Molecular Formula | C21H20ClN3O3S2 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-[4-(pyridin-3-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC[C@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20ClN3O3S2/c1-2-20(29-18-9-5-15(22)6-10-18)21(26)24-16-7-11-19(12-8-16)30(27,28)25-17-4-3-13-23-14-17/h3-14,20,25H,2H2,1H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | QNKSIQISDANVIR-FQEVSTJZSA-N |
| XLogP | 5.05 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |