C18H15ClN4O2S2 — CID 25041089
1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea (PubChem CID 25041089) has the molecular formula C18H15ClN4O2S2 and a molecular weight of 418.93 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 25041089 |
| Molecular Formula | C18H15ClN4O2S2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1)c1ccc(NC(=S)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C18H15ClN4O2S2/c19-13-3-5-15(6-4-13)23-27(24,25)17-9-7-14(8-10-17)21-18(26)22-16-2-1-11-20-12-16/h1-12,23H,(H2,21,22,26) |
| InChIKey | PNWPINPIMWWKJT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|