C21H20ClN3O2S2 — CID 19678548
1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 19678548) has the molecular formula C21H20ClN3O2S2 and a molecular weight of 446.00 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19678548 |
| Molecular Formula | C21H20ClN3O2S2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)c1C |
| InChI | InChI=1S/C21H20ClN3O2S2/c1-14-4-3-5-20(15(14)2)24-21(28)23-17-10-12-19(13-11-17)29(26,27)25-18-8-6-16(22)7-9-18/h3-13,25H,1-2H3,(H2,23,24,28) |
| InChIKey | WCOKWMZYCNDGBQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|