C16H19N3O2S2 — CID 978146
1-(2,3-dimethylphenyl)-3-[(4-methylphenyl)sulfonylamino]thiourea (PubChem CID 978146) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(4-methylphenyl)sulfonylamino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(4-methylphenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 978146 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(4-methylphenyl)sulfonylamino]thiourea |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=S)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-11-7-9-14(10-8-11)23(20,21)19-18-16(22)17-15-6-4-5-12(2)13(15)3/h4-10,19H,1-3H3,(H2,17,18,22) |
| InChIKey | PCKPNNCZCZLAGY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|