C9H12N2O2S3 — CID 11065699
methyl N-[(4-methylphenyl)sulfonylamino]carbamodithioate (PubChem CID 11065699) has the molecular formula C9H12N2O2S3 and a molecular weight of 276.41 g/mol. Its IUPAC name is methyl N-[(4-methylphenyl)sulfonylamino]carbamodithioate.
| Compound Name | methyl N-[(4-methylphenyl)sulfonylamino]carbamodithioate |
|---|---|
| PubChem CID | 11065699 |
| Molecular Formula | C9H12N2O2S3 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | methyl N-[(4-methylphenyl)sulfonylamino]carbamodithioate |
| SMILES | CSC(=S)NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H12N2O2S3/c1-7-3-5-8(6-4-7)16(12,13)11-10-9(14)15-2/h3-6,11H,1-2H3,(H,10,14) |
| InChIKey | DWNVCADXCXWSPB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|