C19H23N3O4S3 — CID 3623626
[2-[2-(4-methylphenyl)sulfonylhydrazinyl]-2-oxoethyl] N-[2-(4-methylphenoxy)ethyl]carbamodithioate (PubChem CID 3623626) has the molecular formula C19H23N3O4S3 and a molecular weight of 453.61 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfonylhydrazinyl]-2-oxoethyl] N-[2-(4-methylphenoxy)ethyl]carbamodithioate.
| Compound Name | [2-[2-(4-methylphenyl)sulfonylhydrazinyl]-2-oxoethyl] N-[2-(4-methylphenoxy)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 3623626 |
| Molecular Formula | C19H23N3O4S3 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfonylhydrazinyl]-2-oxoethyl] N-[2-(4-methylphenoxy)ethyl]carbamodithioate |
| SMILES | Cc1ccc(OCCNC(=S)SCC(=O)NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O4S3/c1-14-3-7-16(8-4-14)26-12-11-20-19(27)28-13-18(23)21-22-29(24,25)17-9-5-15(2)6-10-17/h3-10,22H,11-13H2,1-2H3,(H,20,27)(H,21,23) |
| InChIKey | ZOFNQHOQCILLRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|