C18H22ClN3O4S — CID 36506005
1-[2-(4-chlorophenoxy)ethyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea (PubChem CID 36506005) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 36506005 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)NCCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H22ClN3O4S/c1-14-2-8-17(9-3-14)27(24,25)22-11-10-20-18(23)21-12-13-26-16-6-4-15(19)5-7-16/h2-9,22H,10-13H2,1H3,(H2,20,21,23) |
| InChIKey | BBVSHRHEULCKBS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|