C20H27N3O5S — CID 36962696
1-[2-(2,4-dimethylphenoxy)ethyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea (PubChem CID 36962696) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenoxy)ethyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-[2-(2,4-dimethylphenoxy)ethyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 36962696 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-[2-(2,4-dimethylphenoxy)ethyl]-3-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]urea |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)NCCOc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H27N3O5S/c1-15-4-9-19(16(2)14-15)28-13-12-22-20(24)21-10-11-23-29(25,26)18-7-5-17(27-3)6-8-18/h4-9,14,23H,10-13H2,1-3H3,(H2,21,22,24) |
| InChIKey | GOQUSZFUPLEPGY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|