C20H27NO3S — CID 113100923
4-tert-butyl-N-[2-(2,4-dimethylphenoxy)ethyl]benzenesulfonamide (PubChem CID 113100923) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2,4-dimethylphenoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(2,4-dimethylphenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113100923 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-tert-butyl-N-[2-(2,4-dimethylphenoxy)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(OCCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C20H27NO3S/c1-15-6-11-19(16(2)14-15)24-13-12-21-25(22,23)18-9-7-17(8-10-18)20(3,4)5/h6-11,14,21H,12-13H2,1-5H3 |
| InChIKey | SHDYIGVGXJRWSQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|