C15H18ClNO5S3 — CID 154859485
2-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-5-methylsulfonylthiophene-3-sulfonamide (PubChem CID 154859485) has the molecular formula C15H18ClNO5S3 and a molecular weight of 423.97 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-5-methylsulfonylthiophene-3-sulfonamide.
| Compound Name | 2-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-5-methylsulfonylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 154859485 |
| Molecular Formula | C15H18ClNO5S3 |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 2-chloro-N-[2-(2,4-dimethylphenoxy)ethyl]-5-methylsulfonylthiophene-3-sulfonamide |
| SMILES | Cc1ccc(OCCNS(=O)(=O)c2cc(S(C)(=O)=O)sc2Cl)c(C)c1 |
| InChI | InChI=1S/C15H18ClNO5S3/c1-10-4-5-12(11(2)8-10)22-7-6-17-25(20,21)13-9-14(23-15(13)16)24(3,18)19/h4-5,8-9,17H,6-7H2,1-3H3 |
| InChIKey | OOEOENKNCRMUQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|