C16H17ClFNO3S — CID 113102991
N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 113102991) has the molecular formula C16H17ClFNO3S and a molecular weight of 357.83 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113102991 |
| Molecular Formula | C16H17ClFNO3S |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCOc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C16H17ClFNO3S/c1-11-3-4-12(2)16(9-11)23(20,21)19-7-8-22-15-6-5-13(18)10-14(15)17/h3-6,9-10,19H,7-8H2,1-2H3 |
| InChIKey | XIKVXLHLNOLTGC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|