C20H23ClFN3O4S — CID 55761571
2-chloro-N-[3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-3-oxopropyl]-4-fluorobenzamide (PubChem CID 55761571) has the molecular formula C20H23ClFN3O4S and a molecular weight of 455.94 g/mol. Its IUPAC name is 2-chloro-N-[3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-3-oxopropyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-3-oxopropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55761571 |
| Molecular Formula | C20H23ClFN3O4S |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-chloro-N-[3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-3-oxopropyl]-4-fluorobenzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)CCNC(=O)c2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C20H23ClFN3O4S/c1-13-3-4-14(2)18(11-13)30(28,29)25-10-9-23-19(26)7-8-24-20(27)16-6-5-15(22)12-17(16)21/h3-6,11-12,25H,7-10H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | URCJLNHRMCXTDG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|