C16H16ClFN2O4S — CID 33430634
2-chloro-4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]benzamide (PubChem CID 33430634) has the molecular formula C16H16ClFN2O4S and a molecular weight of 386.83 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 33430634 |
| Molecular Formula | C16H16ClFN2O4S |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClFN2O4S/c1-24-12-3-5-13(6-4-12)25(22,23)20-9-8-19-16(21)14-7-2-11(18)10-15(14)17/h2-7,10,20H,8-9H2,1H3,(H,19,21) |
| InChIKey | BKEZIKWQDDQFJP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|