C16H16ClFN2O3 — CID 91817021
2-chloro-4-fluoro-N-[2-(4-methoxy-2-methyl-6-oxo-1-pyridinyl)ethyl]benzamide (PubChem CID 91817021) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[2-(4-methoxy-2-methyl-6-oxo-1-pyridinyl)ethyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[2-(4-methoxy-2-methyl-6-oxo-1-pyridinyl)ethyl]benzamide |
|---|---|
| PubChem CID | 91817021 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-chloro-4-fluoro-N-[2-(4-methoxy-2-methyl-6-oxo-1-pyridinyl)ethyl]benzamide |
| SMILES | COc1cc(C)n(CCNC(=O)c2ccc(F)cc2Cl)c(=O)c1 |
| InChI | InChI=1S/C16H16ClFN2O3/c1-10-7-12(23-2)9-15(21)20(10)6-5-19-16(22)13-4-3-11(18)8-14(13)17/h3-4,7-9H,5-6H2,1-2H3,(H,19,22) |
| InChIKey | OFQCXDBKEDPCER-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |