C17H21N3O5S — CID 70752609
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 70752609) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70752609 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5,6-dimethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2cc(C)c(C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-11-10-15(17(22)20-12(11)2)16(21)18-8-9-19-26(23,24)14-6-4-13(25-3)5-7-14/h4-7,10,19H,8-9H2,1-3H3,(H,18,21)(H,20,22) |
| InChIKey | QFGQCIQLEBIISG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|