C16H21N3O5S — CID 70754575
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-propan-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 70754575) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-propan-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-propan-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 70754575 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-propan-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2cc(C(C)C)on2)cc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-11(2)15-10-14(19-24-15)16(20)17-8-9-18-25(21,22)13-6-4-12(23-3)5-7-13/h4-7,10-11,18H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | FEHIYRUXQAATFK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|