C19H18N2O6S — CID 33430522
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 33430522) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 33430522 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C19H18N2O6S/c1-26-14-6-8-15(9-7-14)28(24,25)21-11-10-20-18(22)16-12-13-4-2-3-5-17(13)27-19(16)23/h2-9,12,21H,10-11H2,1H3,(H,20,22) |
| InChIKey | BWHVCNQXXCAJSA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|