C15H18N2O4 — CID 104593757
N-[2-(2-hydroxypropylamino)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 104593757) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 104593757 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CC(O)CNCCNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C15H18N2O4/c1-10(18)9-16-6-7-17-14(19)12-8-11-4-2-3-5-13(11)21-15(12)20/h2-5,8,10,16,18H,6-7,9H2,1H3,(H,17,19) |
| InChIKey | UZQOFQBAKHXDSA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|