C14H11F3N2O4 — CID 56742375
2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]chromene-3-carboxamide (PubChem CID 56742375) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 56742375 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-oxo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]chromene-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C14H11F3N2O4/c15-14(16,17)13(22)19-6-5-18-11(20)9-7-8-3-1-2-4-10(8)23-12(9)21/h1-4,7H,5-6H2,(H,18,20)(H,19,22) |
| InChIKey | AYVWAWJDVGTLQE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|