C21H18N2O6 — CID 6612133
[2-[2-[(2-oxochromene-3-carbonyl)amino]ethylcarbamoyl]phenyl] acetate (PubChem CID 6612133) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-[2-[(2-oxochromene-3-carbonyl)amino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [2-[2-[(2-oxochromene-3-carbonyl)amino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 6612133 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-[2-[(2-oxochromene-3-carbonyl)amino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NCCNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H18N2O6/c1-13(24)28-18-9-5-3-7-15(18)19(25)22-10-11-23-20(26)16-12-14-6-2-4-8-17(14)29-21(16)27/h2-9,12H,10-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | AFRNKGPONBTJDD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|