C18H14FNO3 — CID 1244317
N-[2-(4-fluorophenyl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 1244317) has the molecular formula C18H14FNO3 and a molecular weight of 311.31 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1244317 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C18H14FNO3/c19-14-7-5-12(6-8-14)9-10-20-17(21)15-11-13-3-1-2-4-16(13)23-18(15)22/h1-8,11H,9-10H2,(H,20,21) |
| InChIKey | JZFLJPQMHIMSPG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|