C22H16FN3O4 — CID 90516061
N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 90516061) has the molecular formula C22H16FN3O4 and a molecular weight of 405.39 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 90516061 |
| Molecular Formula | C22H16FN3O4 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCn1cnc(-c2ccc(F)cc2)cc1=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H16FN3O4/c23-16-7-5-14(6-8-16)18-12-20(27)26(13-25-18)10-9-24-21(28)17-11-15-3-1-2-4-19(15)30-22(17)29/h1-8,11-13H,9-10H2,(H,24,28) |
| InChIKey | PBALRJRPPXQADF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|